CAS 89797-67-1
:[2-(diaminomethylidene)hydrazinyl](oxo)acetic acid
Description:
[2-(Diaminomethylidene)hydrazinyl](oxo)acetic acid, with the CAS number 89797-67-1, is a chemical compound that features a hydrazine derivative structure. This substance is characterized by the presence of both amino and carboxylic acid functional groups, which contribute to its potential reactivity and solubility in polar solvents. The compound typically exhibits properties associated with hydrazines, such as being a potential reducing agent and having the ability to form coordination complexes with metals. Its structure includes a central carbon atom bonded to an oxo group and a hydrazinyl moiety, which can influence its biological activity and interactions with other molecules. The presence of multiple amine groups suggests that it may participate in hydrogen bonding, enhancing its solubility in aqueous environments. This compound may have applications in pharmaceuticals or as a reagent in organic synthesis, although specific uses would depend on further research into its properties and reactivity. Safety and handling precautions should be observed due to the potential toxicity associated with hydrazine derivatives.
Formula:C3H6N4O3
InChI:InChI=1/C3H6N4O3/c4-3(5)7-6-1(8)2(9)10/h(H,6,8)(H,9,10)(H4,4,5,7)
SMILES:C(=NNC(=N)N)(C(=O)O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

