CAS 89799-64-4
:N-[(Dimethylamino)thioxomethyl]glycine
Description:
N-[(Dimethylamino)thioxomethyl]glycine, with the CAS number 89799-64-4, is a chemical compound that features a glycine backbone modified with a thioxomethyl group and a dimethylamino substituent. This compound is characterized by its unique functional groups, which contribute to its reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the thioxomethyl group suggests that it may exhibit properties related to sulfur chemistry, potentially influencing its biological activity and interaction with other molecules. The dimethylamino group can enhance solubility and may also play a role in the compound's ability to interact with biological systems. As with many such compounds, its stability, solubility, and reactivity can vary depending on environmental conditions such as pH and temperature. Overall, N-[(Dimethylamino)thioxomethyl]glycine represents a class of compounds that may have significant utility in synthetic chemistry and medicinal applications, warranting further investigation into its properties and potential uses.
Formula:C5H10N2O2S
InChI:InChI=1S/C5H10N2O2S/c1-7(2)5(10)6-3-4(8)9/h3H2,1-2H3,(H,6,10)(H,8,9)
InChI key:InChIKey=BMXFKZASWACYST-UHFFFAOYSA-N
SMILES:C(NCC(O)=O)(N(C)C)=S
Synonyms:- N-[(Dimethylamino)thioxomethyl]glycine
- Glycine, N-(dimethylthiocarbamoyl)-
- 2-(3,3-Dimethylthioureido)acetic acid
- 2-[(Dimethylcarbamothioyl)amino]acetic acid
- Glycine, N-[(dimethylamino)thioxomethyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
