CAS 898-22-6

Triethyl-1,3,5-triazine-2,4,6-tricarboxylate

Description:

Triethyl-1,3,5-triazine-2,4,6-tricarboxylate, with CAS number 898-22-6, is an organic compound characterized by its triazine ring structure, which is a six-membered aromatic heterocycle containing three nitrogen atoms. This compound features three carboxylate groups, which contribute to its acidic properties and enhance its solubility in polar solvents. The presence of ethyl groups attached to the triazine ring increases its hydrophobic character, influencing its reactivity and interaction with other substances. Triethyl-1,3,5-triazine-2,4,6-tricarboxylate is often utilized in various chemical applications, including as a reagent in organic synthesis and as a potential intermediate in the production of agrochemicals or pharmaceuticals. Its unique structure allows for diverse chemical reactivity, making it a valuable compound in research and industrial applications. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in its practical use.

Formula: C₁₂H₁₅N₃O₆

InChI: InChI=1/C12H15N3O6/c1-4-19-10(16)7-13-8(11(17)20-5-2)15-9(14-7)12(18)21-6-3/h4-6H2,1-3H3

SMILES: CCOC(=O)c1nc(C(=O)OCC)nc(C(=O)OCC)n1

Synonyms:

• triethyl 1,3,5-triazine-2,4,6-tricarboxylate

Triethyl 1,3,5-triazine-2,4,6-tricarboxylate

CAS: 898-22-6

Formula: C₁₂H₁₅N₃O₆

Purity: 98%

Color and Shape: Solid

Molecular weight: 297.2640

Ref: IN-DA003Z31

Triethyl 1,3,5-triazine-2,4,6-tricarboxylate

CAS: 898-22-6

Triethyl 1,3,5-triazine-2,4,6-tricarboxylate

Purity: 98%

Molecular weight: 297.26g/mol

Ref: 54-OR1027436

Triethyl 1,3,5-triazine-2,4,6-tricarboxylate

CAS: 898-22-6

Purity: 98%

Molecular weight: 297.2669983

Ref: 10-F635267

Triethyl 1,3,5-triazine-2,4,6-tricarboxylate

CAS: 898-22-6

Triethyl 1,3,5-triazine-2,4,6-tricarboxylate is a conformationally constrained triazine derivative that has been rationalized to have amide and amine moieties. Triethyl 1,3,5-triazine-2,4,6-tricarboxylate has been shown to be an acceptor for chloride modification in the gas phase. This compound may be an optimized molecule for the synthesis of triazines with carboxylic acid substituents by postulating its diffraction pattern. The presence of the azide group is thermally stable and prevents decomposition.

Formula: C₁₂H₁₅N₃O₆

Purity: Min. 95%

Molecular weight: 297.26 g/mol

Ref: 3D-AAA89822