
CAS 89804-66-0
:3-Phenyl-5-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazole
Description:
3-Phenyl-5-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazole is an organic compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. This compound features a phenyl group at the 3-position and a para-trifluoromethylphenyl group at the 5-position, contributing to its unique electronic and steric properties. The presence of the trifluoromethyl group enhances lipophilicity and can influence the compound's reactivity and biological activity. Typically, compounds of this class exhibit interesting photophysical properties, making them potential candidates for applications in materials science, such as organic light-emitting diodes (OLEDs) and fluorescence-based sensors. Additionally, the oxadiazole moiety is known for its stability and ability to participate in various chemical reactions, which can be exploited in synthetic chemistry. Overall, 3-Phenyl-5-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazole represents a versatile structure with potential applications in both research and industry.
Formula:C15H9F3N2O
InChI:InChI=1S/C15H9F3N2O/c16-15(17,18)12-8-6-11(7-9-12)14-19-13(20-21-14)10-4-2-1-3-5-10/h1-9H
InChI key:InChIKey=JFJJBJKKRQTYSD-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CC=C(C2=NC(=NO2)C3=CC=CC=C3)C=C1
Synonyms:- 3-Phenyl-5-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazole
- 1,2,4-Oxadiazole, 3-phenyl-5-[4-(trifluoromethyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,2,4-Oxadiazole, 3-phenyl-5-[4-(trifluoromethyl)phenyl]-
CAS:Formula:C15H9F3N2OMolecular weight:290.24
