CAS 898044-50-3

4-Chloro-5-fluoro-2-methylpyrimidine

Description:

4-Chloro-5-fluoro-2-methylpyrimidine is a heterocyclic organic compound characterized by a pyrimidine ring, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features a chlorine atom at the 4-position and a fluorine atom at the 5-position, along with a methyl group at the 2-position of the pyrimidine ring. Its molecular formula typically reflects the presence of these substituents, contributing to its unique chemical properties. The presence of halogens (chlorine and fluorine) often enhances the compound's reactivity and can influence its solubility and stability. 4-Chloro-5-fluoro-2-methylpyrimidine may be utilized in various applications, including pharmaceuticals and agrochemicals, due to its potential biological activity. The compound's structure allows for various synthetic modifications, making it a valuable intermediate in organic synthesis. Safety data should be consulted for handling, as halogenated compounds can pose specific health and environmental risks.

Formula: C₅H₄ClFN₂

InChI: InChI=1/C5H4ClFN2/c1-3-8-2-4(7)5(6)9-3/h2H,1H3

SMILES: Cc1ncc(c(Cl)n1)F

Synonyms:

• 5-Fluoro-4-chloro-2-methylpyrimidine
• Pyrimidine, 4-Chloro-5-Fluoro-2-Methyl-
• 4-Chloro-5-Fluoro-2-Methyl-Pyrimidine

4-Chloro-5-fluoro-2-methylpyrimidine

CAS: 898044-50-3

Formula: C₅H₄ClFN₂

Purity: 96%

Color and Shape: Liquid

Molecular weight: 146.5501

Ref: IN-DA0086UG

4-Chloro-5-fluoro-2-methylpyrimidine

CAS: 898044-50-3

4-Chloro-5-fluoro-2-methylpyrimidine

Purity: 96%

Color and Shape: Liquid

Molecular weight: 146.55g/mol

Ref: 54-PC201366

4-Chloro-5-fluoro-2-methylpyrimidine

CAS: 898044-50-3

Formula: C₅H₄ClFN₂

Purity: 98%

Color and Shape: Liquid

Molecular weight: 146.55

Ref: 10-F078138