
CAS 898045-39-1
:4-Chloro-5-methoxy-6-(4-piperidinyloxy)pyrimidine
Description:
4-Chloro-5-methoxy-6-(4-piperidinyloxy)pyrimidine is a chemical compound characterized by its pyrimidine core, which is a six-membered heterocyclic ring containing two nitrogen atoms at positions 1 and 3. The presence of a chloro group at the 4-position and a methoxy group at the 5-position contributes to its unique reactivity and solubility properties. The 6-position features a piperidinyloxy substituent, which enhances its potential for biological activity, particularly in medicinal chemistry. This compound may exhibit properties such as being a potential pharmacological agent, with applications in various therapeutic areas. Its molecular structure suggests it could interact with biological targets, making it of interest for drug development. Additionally, the presence of both halogen and ether functionalities may influence its lipophilicity and overall stability. As with many synthetic organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C10H14ClN3O2
InChI:InChI=1S/C10H14ClN3O2/c1-15-8-9(11)13-6-14-10(8)16-7-2-4-12-5-3-7/h6-7,12H,2-5H2,1H3
InChI key:InChIKey=MZLUZUNCYWMYAM-UHFFFAOYSA-N
SMILES:O(C=1C(OC)=C(Cl)N=CN1)C2CCNCC2
Synonyms:- 4-Chloro-5-methoxy-6-(4-piperidinyloxy)pyrimidine
- Pyrimidine, 4-chloro-5-methoxy-6-(4-piperidinyloxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.