CAS 89805-41-4
:(2Z,5Z)-2-imino-5-(2-oxo-2-phenylethylidene)-3-phenyl-1,3-oxazolidin-4-one
Description:
(2Z,5Z)-2-imino-5-(2-oxo-2-phenylethylidene)-3-phenyl-1,3-oxazolidin-4-one, with CAS number 89805-41-4, is a chemical compound characterized by its oxazolidinone structure, which features a five-membered ring containing both nitrogen and oxygen atoms. This compound exhibits a unique configuration due to the presence of imino and carbonyl functional groups, contributing to its potential reactivity and biological activity. The phenyl groups attached to the oxazolidinone ring enhance its lipophilicity, which may influence its solubility and interaction with biological systems. The specific stereochemistry indicated by the (2Z,5Z) notation suggests that the compound has defined geometric isomerism, which can significantly affect its pharmacological properties. Such compounds are often studied for their potential applications in medicinal chemistry, particularly as antimicrobial or anticancer agents. Overall, the structural features of this compound suggest a complex interplay of chemical properties that could be explored for various applications in research and industry.
Formula:C17H12N2O3
InChI:InChI=1/C17H12N2O3/c18-17-19(13-9-5-2-6-10-13)16(21)15(22-17)11-14(20)12-7-3-1-4-8-12/h1-11,18H/b15-11-,18-17-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-IMINO-5-(2-OXO-2-PHENYLETHYLIDENE)-3-PHENYL-4-OXAZOLIDINONE
CAS:Formula:C17H12N2O3Molecular weight:292.2888
