
CAS 89807-44-3
:Benzene, 1-(chlorodifluoromethoxy)-4-(chloromethyl)-
Description:
Benzene, 1-(chlorodifluoromethoxy)-4-(chloromethyl)-, also known by its CAS number 89807-44-3, is an organic compound characterized by a benzene ring substituted with both chlorodifluoromethoxy and chloromethyl groups. This compound typically exhibits properties associated with aromatic compounds, such as stability and a distinct reactivity profile due to the presence of electron-withdrawing groups. The chlorodifluoromethoxy group introduces both chlorine and fluorine atoms, which can enhance the compound's lipophilicity and influence its interaction with biological systems. The chloromethyl group can serve as a reactive site for further chemical transformations. In terms of physical properties, it may be a colorless to pale yellow liquid or solid, depending on its state at room temperature. The presence of halogen substituents often contributes to its potential applications in agrochemicals, pharmaceuticals, and materials science, while also necessitating careful handling due to possible toxicity and environmental concerns associated with halogenated compounds.
Formula:C8H6Cl2F2O
InChI:InChI=1S/C8H6Cl2F2O/c9-5-6-1-3-7(4-2-6)13-8(10,11)12/h1-4H,5H2
InChI key:InChIKey=RUBFUVFBAFIGMM-UHFFFAOYSA-N
SMILES:O(C(Cl)(F)F)C1=CC=C(CCl)C=C1
Synonyms:- 1-(Chlorodifluoromethoxy)-4-(chloromethyl)benzene
- Benzene, 1-(chlorodifluoromethoxy)-4-(chloromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
