CAS 89807-88-5
:1-Ethoxy-3,3,4,4,5,5,6,6,6-nonafluoro-2-hexanol
Description:
1-Ethoxy-3,3,4,4,5,5,6,6,6-nonafluoro-2-hexanol, with CAS number 89807-88-5, is a fluorinated alcohol characterized by its unique structure that includes a long carbon chain and multiple fluorine atoms. This compound features an ethoxy group, which contributes to its solubility properties, and a nonafluoroalkyl chain that imparts hydrophobic characteristics. The presence of fluorine atoms enhances its thermal stability and chemical resistance, making it useful in various applications, including as a surfactant or in formulations requiring low surface tension. The compound is likely to exhibit low volatility and high surface activity due to its fluorinated nature. Additionally, it may have specific interactions with biological systems, necessitating careful handling and assessment of its environmental impact. Overall, 1-Ethoxy-3,3,4,4,5,5,6,6,6-nonafluoro-2-hexanol is notable for its unique combination of properties derived from both its ethoxy and fluorinated components.
Formula:C8H9F9O2
InChI:InChI=1S/C8H9F9O2/c1-2-19-3-4(18)5(9,10)6(11,12)7(13,14)8(15,16)17/h4,18H,2-3H2,1H3
InChI key:InChIKey=CFHMZROKMSLQRX-UHFFFAOYSA-N
SMILES:C(C(C(COCC)O)(F)F)(C(C(F)(F)F)(F)F)(F)F
Synonyms:- 1-Ethoxy-3,3,4,4,5,5,6,6,6-nonafluoro-2-hexanol
- 2-Hexanol, 1-ethoxy-3,3,4,4,5,5,6,6,6-nonafluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
