
CAS 898074-79-8
:N-Ethyl-2,4-difluorobenzenesulfonamide
Description:
N-Ethyl-2,4-difluorobenzenesulfonamide is a chemical compound characterized by its sulfonamide functional group, which is known for its applications in pharmaceuticals and agrochemicals. This compound features a benzene ring substituted with two fluorine atoms at the 2 and 4 positions, enhancing its reactivity and potential biological activity. The ethyl group attached to the nitrogen atom of the sulfonamide contributes to its lipophilicity, which can influence its solubility and permeability in biological systems. The presence of fluorine atoms often imparts unique electronic properties, making such compounds of interest in medicinal chemistry for developing new therapeutic agents. Additionally, the sulfonamide moiety is recognized for its antibacterial properties, although the specific biological activity of N-Ethyl-2,4-difluorobenzenesulfonamide would depend on its interaction with biological targets. Overall, this compound exemplifies the intersection of organic chemistry and pharmacology, with potential applications in drug development and chemical synthesis.
Formula:C8H9F2NO2S
InChI:InChI=1S/C8H9F2NO2S/c1-2-11-14(12,13)8-4-3-6(9)5-7(8)10/h3-5,11H,2H2,1H3
InChI key:InChIKey=MHUOTEXKCWHNAY-UHFFFAOYSA-N
SMILES:S(NCC)(=O)(=O)C1=C(F)C=C(F)C=C1
Synonyms:- N-Ethyl-2,4-difluorobenzenesulfonamide
- Benzenesulfonamide, N-ethyl-2,4-difluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.