CAS 89809-89-2
:5-Acetyl-2-amino-6-methyl-4-phenyl-4H-pyran-3-carbonitrile
Description:
5-Acetyl-2-amino-6-methyl-4-phenyl-4H-pyran-3-carbonitrile, with the CAS number 89809-89-2, is a chemical compound that belongs to the class of pyran derivatives. This compound features a pyran ring, which is a six-membered heterocyclic structure containing one oxygen atom. Its molecular structure includes an acetyl group, an amino group, and a phenyl group, contributing to its potential reactivity and biological activity. The presence of the carbonitrile functional group indicates that it may exhibit properties such as nucleophilicity and the ability to participate in various chemical reactions, including nucleophilic addition and cyclization. The compound's unique combination of functional groups suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Additionally, its structural characteristics may influence its solubility, stability, and interaction with biological targets. Overall, 5-Acetyl-2-amino-6-methyl-4-phenyl-4H-pyran-3-carbonitrile represents a compound of interest for further research in organic synthesis and drug discovery.
Formula:C15H14N2O2
InChI:InChI=1/C15H14N2O2/c1-9(18)13-10(2)19-15(17)12(8-16)14(13)11-6-4-3-5-7-11/h3-7,14H,17H2,1-2H3
SMILES:CC(=O)C1=C(C)OC(=C(C#N)C1c1ccccc1)N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.