CAS 89810-44-6
:N-formylisoleucine
Description:
N-formylisoleucine is an amino acid derivative characterized by the presence of a formyl group attached to the isoleucine backbone. It is a non-proteinogenic amino acid, meaning it is not incorporated into proteins during translation but can play roles in various biochemical processes. The molecular structure features a branched-chain aliphatic side group typical of isoleucine, which contributes to its hydrophobic properties. N-formylisoleucine is often studied in the context of peptide synthesis and may exhibit unique biological activities, including potential roles in signaling pathways or as a precursor in the synthesis of other bioactive compounds. Its CAS number, 89810-44-6, allows for precise identification in chemical databases. As with many amino acid derivatives, it may exhibit solubility in polar solvents and could participate in various chemical reactions, including acylation and amidation. Understanding its properties and reactivity is essential for applications in medicinal chemistry and biochemistry.
Formula:C7H13NO3
InChI:InChI=1/C7H13NO3/c1-3-5(2)6(7(10)11)8-4-9/h4-6H,3H2,1-2H3,(H,8,9)(H,10,11)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

