CAS 89813-56-9
:2H-1,2,4-Benzothiadiazine-7-sulfonamide, 6-chloro-3,4-dihydro-3-oxo-, 1,1-dioxide
Description:
2H-1,2,4-Benzothiadiazine-7-sulfonamide, 6-chloro-3,4-dihydro-3-oxo-, 1,1-dioxide, commonly referred to as a benzothiadiazine derivative, is a chemical compound characterized by its heterocyclic structure, which includes a benzene ring fused to a thiadiazine ring. This compound features a sulfonamide group, which contributes to its potential biological activity, particularly in medicinal chemistry. The presence of a chlorine atom at the 6-position and a keto group enhances its reactivity and may influence its pharmacological properties. Typically, compounds of this class exhibit properties such as diuretic and antihypertensive effects, making them of interest in the development of therapeutic agents. The sulfonamide moiety is known for its ability to inhibit certain enzymes, which can be beneficial in various medical applications. Additionally, the compound's stability and solubility characteristics are influenced by its functional groups, which can affect its bioavailability and overall efficacy in biological systems.
Formula:C7H6ClN3O5S2
InChI:InChI=1S/C7H6ClN3O5S2/c8-3-1-4-6(2-5(3)17(9,13)14)18(15,16)11-7(12)10-4/h1-2H,(H2,9,13,14)(H2,10,11,12)
InChI key:InChIKey=CLWJBTNSDQIMNT-UHFFFAOYSA-N
SMILES:O=S1(=O)C=2C(=CC(Cl)=C(S(N)(=O)=O)C2)NC(=O)N1
Synonyms:- NSC 525339
- 2H-1,2,4-Benzothiadiazine-7-sulfonamide, 6-chloro-3,4-dihydro-3-oxo-, 1,1-dioxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
