CAS 89814-99-3

1-(benzylideneamino)-4,6-dimethyl-2-oxo-1,2-dihydropyridine-3-carbonitrile

Description:

1-(Benzylideneamino)-4,6-dimethyl-2-oxo-1,2-dihydropyridine-3-carbonitrile, with the CAS number 89814-99-3, is a chemical compound that belongs to the class of dihydropyridine derivatives. This compound features a dihydropyridine ring, which is characterized by its five-membered structure containing nitrogen and carbon atoms. The presence of a benzylideneamino group indicates that it has an imine functional group, contributing to its reactivity and potential biological activity. The carbonitrile group adds to its chemical properties, making it a potential candidate for various applications in medicinal chemistry. The dimethyl substitutions at the 4 and 6 positions of the dihydropyridine ring can influence the compound's steric and electronic properties, potentially affecting its interactions with biological targets. Overall, this compound may exhibit interesting pharmacological activities, making it a subject of interest for further research in drug development and synthesis.

Formula: C₁₅H₁₃N₃O

InChI: InChI=1/C15H13N3O/c1-11-8-12(2)18(15(19)14(11)9-16)17-10-13-6-4-3-5-7-13/h3-8,10H,1-2H3

SMILES: Cc1cc(C)n(c(=O)c1C#N)N=Cc1ccccc1

1-(benzylideneamino)-4,6-dimethyl-2-oxo-pyridine-3-carbonitrile

CAS: 89814-99-3

Formula: C₁₅H₁₃N₃O

Molecular weight: 251.2832

Ref: IN-DA003Z6Z