
CAS 89816-55-7
:5-Methyl-2-(2-propen-1-yl)benzo[b]thiophene
Description:
5-Methyl-2-(2-propen-1-yl)benzo[b]thiophene, with the CAS number 89816-55-7, is an organic compound that belongs to the class of thiophene derivatives. This substance features a thiophene ring fused to a benzene ring, which contributes to its aromatic properties. The presence of a methyl group and a propenyl substituent enhances its reactivity and may influence its physical and chemical properties, such as solubility and boiling point. Typically, compounds of this nature exhibit interesting electronic characteristics due to the conjugated system formed by the aromatic rings and the double bonds in the propenyl group. These features may also impart biological activity, making such compounds of interest in medicinal chemistry and materials science. Additionally, the compound's structure suggests potential applications in organic synthesis and as intermediates in the production of more complex molecules. However, specific data regarding its toxicity, stability, and reactivity would require further investigation through experimental studies and literature review.
Formula:C12H12S
InChI:InChI=1S/C12H12S/c1-3-4-11-8-10-7-9(2)5-6-12(10)13-11/h3,5-8H,1,4H2,2H3
InChI key:InChIKey=MYJNBNHUJPOMFS-UHFFFAOYSA-N
SMILES:C(C=C)C1=CC=2C(S1)=CC=C(C)C2
Synonyms:- Benzo[b]thiophene, 5-methyl-2-(2-propenyl)-
- Benzo[b]thiophene, 5-methyl-2-(2-propen-1-yl)-
- 5-Methyl-2-(2-propen-1-yl)benzo[b]thiophene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
