CAS 89819-42-1

2,2-Difluoro-1,3-benzodioxole-4-sulfonyl chloride

Description:

2,2-Difluoro-1,3-benzodioxole-4-sulfonyl chloride, with the CAS number 89819-42-1, is a chemical compound characterized by its unique structure that includes a benzodioxole moiety and a sulfonyl chloride functional group. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its reactivity, particularly due to the presence of the sulfonyl chloride group, which can undergo nucleophilic substitution reactions, making it useful in organic synthesis and as a reagent in various chemical reactions. The difluoro substitution enhances its electrophilic character, allowing it to participate in diverse chemical transformations. Additionally, this compound may exhibit properties such as moderate solubility in organic solvents and stability under standard laboratory conditions, although it should be handled with care due to its potential reactivity and toxicity. Proper safety measures, including the use of personal protective equipment, are recommended when working with this substance.

Formula: C₇H₃ClF₂O₄S

InChI: InChI=1S/C7H3ClF2O4S/c8-15(11,12)5-3-1-2-4-6(5)14-7(9,10)13-4/h1-3H

InChI key: InChIKey=RSCUQVIKWLIGNV-UHFFFAOYSA-N

SMILES: S(Cl)(=O)(=O)C1=C2C(OC(F)(F)O2)=CC=C1

Synonyms:

• 2,2-Difluoro-1,3-dioxaindane-4-sulfonyl chloride
• 2,2-Difluoro-1,3-benzodioxole-4-sulfonyl chloride
• 1,3-Benzodioxole-4-sulfonyl chloride, 2,2-difluoro-
• 2,2-Difluoro-2H-1,3-benzodioxole-4-sulfonyl chloride

2,2-difluoro-1,3-dioxaindane-4-sulfonyl chloride

CAS: 89819-42-1

Formula: C₇H₃ClF₂O₄S

Purity: 95%

Color and Shape: Liquid

Molecular weight: 256.6111

Ref: IN-DA003Y0A

2,2-Difluorobenzo[d][1,3]dioxole-4-sulfonyl chloride

CAS: 89819-42-1

2,2-Difluorobenzo[d][1,3]dioxole-4-sulfonyl chloride

Purity: 95%

Molecular weight: 256.61g/mol

Ref: 54-PC1003858