CAS 898282-29-6

N-[1-[4-(Trifluoromethyl)phenyl]ethylidene]benzenamine

Description:

N-[1-[4-(Trifluoromethyl)phenyl]ethylidene]benzenamine, identified by its CAS number 898282-29-6, is an organic compound characterized by its complex structure featuring both an ethylidene and an aniline moiety. The presence of a trifluoromethyl group on the phenyl ring significantly influences its chemical properties, enhancing its lipophilicity and potentially affecting its reactivity and biological activity. This compound is likely to exhibit properties typical of aromatic amines, including potential applications in organic synthesis and medicinal chemistry. Its molecular structure suggests it may participate in various chemical reactions, such as electrophilic aromatic substitution or nucleophilic addition, due to the electron-withdrawing nature of the trifluoromethyl group. Additionally, the compound's stability, solubility, and interaction with biological systems would be influenced by its functional groups and overall molecular geometry. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of fluorinated groups, which can pose unique environmental and health considerations.

Formula: C₁₅H₁₂F₃N

InChI: InChI=1S/C15H12F3N/c1-11(19-14-5-3-2-4-6-14)12-7-9-13(10-8-12)15(16,17)18/h2-10H,1H3

InChI key: InChIKey=FSNVUIDWCYKPAV-UHFFFAOYSA-N

SMILES: C(=NC1=CC=CC=C1)(C)C2=CC=C(C(F)(F)F)C=C2

Synonyms:

• N-[1-[4-(Trifluoromethyl)phenyl]ethylidene]benzenamine
• Benzenamine, N-[1-[4-(trifluoromethyl)phenyl]ethylidene]-

Benzenamine, N-[1-[4-(trifluoromethyl)phenyl]ethylidene]-

CAS: 898282-29-6

Formula: C₁₅H₁₂F₃N

Molecular weight: 263.2577

Ref: IN-DA003XMF