CAS 898288-88-5

pentafluorophenyl 1-methyl-1H-imidazole-4-carboxylate

Description:

Pentafluorophenyl 1-methyl-1H-imidazole-4-carboxylate is a chemical compound characterized by its unique structure, which includes a pentafluorophenyl group and an imidazole ring. The presence of five fluorine atoms on the phenyl ring significantly enhances its electron-withdrawing properties, making it a highly reactive compound in various chemical reactions. The imidazole moiety contributes to its potential biological activity, as imidazole derivatives are often found in pharmaceuticals and agrochemicals. This compound is typically used as an intermediate in organic synthesis, particularly in the development of more complex molecules. Its solubility and stability can vary depending on the solvent and conditions used, and it may exhibit interesting properties such as fluorescence or specific reactivity towards nucleophiles due to the electrophilic nature of the pentafluorophenyl group. Safety precautions should be taken when handling this compound, as fluorinated compounds can pose environmental and health risks. Overall, pentafluorophenyl 1-methyl-1H-imidazole-4-carboxylate is a valuable compound in synthetic chemistry with potential applications in various fields.

Formula: C₁₁H₅F₅N₂O₂

InChI: InChI=1/C11H5F5N2O2/c1-18-2-4(17-3-18)11(19)20-10-8(15)6(13)5(12)7(14)9(10)16/h2-3H,1H3

SMILES: Cn1cc(C(=O)Oc2c(c(c(c(c2F)F)F)F)F)nc1

Pentafluorophenyl 1-methyl-1H-imidazole-4-carboxylate

CAS: 898288-88-5

Pentafluorophenyl 1-methyl-1H-imidazole-4-carboxylate

Purity: ≥95%

Molecular weight: 292.16161g/mol

Ref: 54-PC4386

Pentafluorophenyl 1-methyl-1H-imidazole-4-carboxylate

Controlled Product

CAS: 898288-88-5

Please enquire for more information about Pentafluorophenyl 1-methyl-1H-imidazole-4-carboxylate including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₁H₅F₅N₂O₂

Purity: Min. 95%

Molecular weight: 292.16 g/mol

Ref: 3D-FP93649