CymitQuimica logo

CAS 898289-18-4

:

3-isocyanato-5-methyl-2-phenylfuran

Description:
3-Isocyanato-5-methyl-2-phenylfuran is an organic compound characterized by its furan ring, which is a five-membered aromatic heterocycle containing oxygen. The presence of an isocyanate group (-N=C=O) indicates that this compound can participate in nucleophilic addition reactions, making it reactive towards amines and alcohols. The methyl and phenyl substituents contribute to its hydrophobic character and influence its solubility in organic solvents. This compound may exhibit unique properties such as specific reactivity patterns, thermal stability, and potential applications in the synthesis of polymers or pharmaceuticals. Additionally, the isocyanate functional group is known for its potential toxicity and reactivity, necessitating careful handling and storage. Overall, 3-isocyanato-5-methyl-2-phenylfuran is a versatile compound with significant implications in chemical synthesis and materials science.
Formula:C12H9NO2
InChI:InChI=1/C12H9NO2/c1-9-7-11(13-8-14)12(15-9)10-5-3-2-4-6-10/h2-7H,1H3
SMILES:Cc1cc(c(c2ccccc2)o1)N=C=O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.