CAS 898289-25-3

2-(4-Thiomorpholinyl)-4-pyridinemethanol

Description:

2-(4-Thiomorpholinyl)-4-pyridinemethanol, with the CAS number 898289-25-3, is a chemical compound characterized by its unique structural features, which include a pyridine ring and a thiomorpholine moiety. This compound typically exhibits properties associated with both heterocyclic and alcohol functionalities, making it of interest in various fields, including medicinal chemistry. The presence of the thiomorpholine group may impart specific biological activities, potentially influencing its pharmacological profile. The hydroxyl group (-OH) attached to the pyridine ring can participate in hydrogen bonding, affecting solubility and reactivity. Additionally, the compound's molecular structure suggests it may engage in interactions with biological targets, which could be relevant for drug development. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be evaluated for its potential applications in therapeutic contexts. As with many chemical substances, safety data and handling precautions should be considered when working with this compound in laboratory settings.

Formula: C₁₀H₁₄N₂OS

InChI: InChI=1S/C10H14N2OS/c13-8-9-1-2-11-10(7-9)12-3-5-14-6-4-12/h1-2,7,13H,3-6,8H2

InChI key: InChIKey=KDJBEJVGUFHDPW-UHFFFAOYSA-N

SMILES: C(O)C=1C=C(N=CC1)N2CCSCC2

Synonyms:

• 2-(4-Thiomorpholinyl)-4-pyridinemethanol
• 4-Pyridinemethanol, 2-(4-thiomorpholinyl)-

(2-Thiomorpholinopyridin-4-yl)methanol

CAS: 898289-25-3

Formula: C₁₀H₁₄N₂OS

Molecular weight: 210.2960

Ref: IN-DA003XPG

[2-(Thiomorpholin-4-yl)pyridin-4-yl]methanol

CAS: 898289-25-3

[2-(Thiomorpholin-4-yl)pyridin-4-yl]methanol

Purity: ≥95%

Molecular weight: 210.30g/mol

Ref: 54-OR12361