CymitQuimica logo

CAS 898289-29-7

:

2-(tetrahydro-2H-pyran-4-yloxy)benzoic acid

Description:
2-(Tetrahydro-2H-pyran-4-yloxy)benzoic acid is an organic compound characterized by its unique structure, which includes a benzoic acid moiety linked to a tetrahydro-2H-pyran group through an ether bond. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential solubility in various organic solvents. The presence of the carboxylic acid functional group imparts acidic characteristics, allowing it to participate in acid-base reactions. Additionally, the tetrahydro-pyran ring can influence the compound's conformational flexibility and steric properties, which may affect its reactivity and interactions with biological targets. This compound may be of interest in medicinal chemistry and materials science due to its potential applications in drug development or as a building block in synthetic pathways. Its specific physical and chemical properties, such as melting point, boiling point, and spectral characteristics, would require empirical measurement or detailed literature references for precise values.
Formula:C12H14O4
InChI:InChI=1/C12H14O4/c13-12(14)10-3-1-2-4-11(10)16-9-5-7-15-8-6-9/h1-4,9H,5-8H2,(H,13,14)
SMILES:c1ccc(c(c1)C(=O)O)OC1CCOCC1
Synonyms:
  • 2-(Tetrahydropyran-4-Yloxy)Benzoic Acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.