CAS 898289-51-5

2-[3-(chloromethyl)phenyl]pyrimidine

Description:

2-[3-(Chloromethyl)phenyl]pyrimidine is an organic compound characterized by its pyrimidine ring, which is a six-membered heterocyclic structure containing two nitrogen atoms at positions 1 and 3. The compound features a chloromethyl group attached to a phenyl ring at the 3-position, contributing to its reactivity and potential applications in medicinal chemistry. This substitution can influence the compound's physical properties, such as solubility and boiling point, as well as its biological activity. The presence of the chloromethyl group may facilitate further chemical modifications, making it a useful intermediate in the synthesis of more complex molecules. Additionally, the compound's structure suggests potential interactions with biological targets, which could be explored for therapeutic purposes. As with many chlorinated compounds, considerations regarding environmental impact and safety during handling and disposal are important. Overall, 2-[3-(chloromethyl)phenyl]pyrimidine represents a versatile scaffold in organic synthesis and drug development.

Formula: C₁₁H₉ClN₂

InChI: InChI=1/C11H9ClN2/c12-8-9-3-1-4-10(7-9)11-13-5-2-6-14-11/h1-7H,8H2

SMILES: c1cc(cc(c1)c1ncccn1)CCl

Pyrimidine, 2-[3-(chloromethyl)phenyl]-

CAS: 898289-51-5

Formula: C₁₁H₉ClN₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 204.6556

Ref: IN-DA003XM9

3-(Pyrimidin-2-yl)benzyl chloride

CAS: 898289-51-5

3-(Pyrimidin-2-yl)benzyl chloride

Purity: 97%

Molecular weight: 204.66g/mol

Ref: 54-OR12242

2-(3-(Chloromethyl)phenyl)pyrimidine

CAS: 898289-51-5

Purity: 98%

Molecular weight: 204.6600037

Ref: 10-F779037

2-[3-(Chloromethyl)phenyl]pyrimidine

Controlled Product

CAS: 898289-51-5

Applications 2-[3-(chloromethyl)phenyl]pyrimidine (cas# 898289-51-5) is a useful research chemical.

Formula: C₁₁H₉N₂Cl

Color and Shape: Neat

Molecular weight: 204.66

Ref: TR-C650250