CAS 898289-54-8
:6-[(Tetrahydro-2H-pyran-4-yl)oxy]-2-pyridinecarboxaldehyde
Description:
6-[(Tetrahydro-2H-pyran-4-yl)oxy]-2-pyridinecarboxaldehyde, identified by its CAS number 898289-54-8, is an organic compound characterized by its pyridine and aldehyde functional groups. This compound features a pyridine ring substituted at the 2-position with a carboxaldehyde group, which contributes to its reactivity and potential applications in organic synthesis. The tetrahydro-2H-pyran moiety introduces a cyclic ether structure, enhancing the compound's solubility and stability in various solvents. The presence of the ether linkage may also influence its biological activity and interactions with other molecules. Typically, compounds of this nature are of interest in medicinal chemistry and may exhibit properties such as antimicrobial or anti-inflammatory activities. The molecular structure suggests potential for further derivatization, making it a valuable intermediate in the synthesis of more complex organic molecules. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C11H13NO3
InChI:InChI=1S/C11H13NO3/c13-8-9-2-1-3-11(12-9)15-10-4-6-14-7-5-10/h1-3,8,10H,4-7H2
InChI key:InChIKey=SBTGZJPHUYLRRU-UHFFFAOYSA-N
SMILES:O(C=1N=C(C=O)C=CC1)C2CCOCC2
Synonyms:- 6-[(Tetrahydro-2H-pyran-4-yl)oxy]-2-pyridinecarboxaldehyde
- 2-Pyridinecarboxaldehyde, 6-[(tetrahydro-2H-pyran-4-yl)oxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
