CymitQuimica logo

CAS 898289-64-0

:

2-(5-Methyl-1,3,4-oxadiazol-2-yl)benzoic acid

Description:
2-(5-Methyl-1,3,4-oxadiazol-2-yl)benzoic acid is a chemical compound characterized by its unique structure, which includes a benzoic acid moiety and a 5-methyl-1,3,4-oxadiazole ring. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar organic solvents due to the presence of the carboxylic acid functional group. The oxadiazole ring contributes to its potential biological activity, making it of interest in pharmaceutical research. The compound may display moderate to high stability under standard conditions, but its reactivity can vary depending on the functional groups present. Additionally, it may participate in hydrogen bonding due to the carboxylic acid group, influencing its interactions in biological systems. Overall, 2-(5-Methyl-1,3,4-oxadiazol-2-yl)benzoic acid is a compound of interest for its potential applications in medicinal chemistry and materials science, warranting further investigation into its properties and uses.
Formula:C10H8N2O3
InChI:InChI=1S/C10H8N2O3/c1-6-11-12-9(15-6)7-4-2-3-5-8(7)10(13)14/h2-5H,1H3,(H,13,14)
InChI key:InChIKey=KBQBJFWYPQURSO-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C=CC=C1)C2=NN=C(C)O2
Synonyms:
  • Benzoic acid, 2-(5-methyl-1,3,4-oxadiazol-2-yl)-
  • 2-(5-Methyl-1,3,4-oxadiazol-2-yl)benzoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.