CAS 89829-63-0

N-Hydroxy-4-thiazolecarboximidamide

Description:

N-Hydroxy-4-thiazolecarboximidamide is a chemical compound characterized by its unique structural features, which include a thiazole ring and a hydroxylamine functional group. This compound is typically recognized for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to act as a bioactive molecule. The presence of the thiazole moiety contributes to its biological activity, as thiazoles are known for their roles in various biochemical processes. Additionally, the hydroxylamine group can participate in redox reactions, making it a versatile intermediate in organic synthesis. The compound is generally stable under standard conditions but may require specific handling and storage protocols to maintain its integrity. As with many chemical substances, safety data sheets should be consulted to understand its toxicity, reactivity, and safe handling practices. Overall, N-Hydroxy-4-thiazolecarboximidamide represents a significant compound in the realm of chemical research and development.

Formula: C₄H₅N₃OS

InChI: InChI=1S/C4H5N3OS/c5-4(7-8)3-1-9-2-6-3/h1-2,8H,(H2,5,7)

InChI key: InChIKey=BRKDONHOSNVLSH-UHFFFAOYSA-N

SMILES: C(NO)(=N)C1=CSC=N1

Synonyms:

• N-Hydroxy-4-thiazolecarboximidamide
• 4-Thiazolecarboximidamide, N-hydroxy-
• 4-Thiazolecarboxamidoxime