CymitQuimica logo

CAS 89830-71-7

:

N'-aminopyridine-4-carboxamidine dihydrochloride

Description:
N'-Aminopyridine-4-carboxamidine dihydrochloride is a chemical compound characterized by its structure, which includes a pyridine ring substituted with an amino group and a carboxamidine functional group. This compound is typically encountered as a dihydrochloride salt, which enhances its solubility in aqueous solutions. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its biological activity. The presence of both amino and carboxamidine groups suggests that it may participate in various chemical reactions, including those involving nucleophilic attack or hydrogen bonding. The compound is often studied for its role in modulating biological pathways, and its properties can be influenced by factors such as pH and solvent conditions. Safety data should be consulted for handling, as with any chemical substance, to ensure proper laboratory practices are followed. Overall, N'-aminopyridine-4-carboxamidine dihydrochloride represents a versatile compound of interest in both research and potential therapeutic applications.
Formula:C6H10Cl2N4
InChI:InChI=1/C6H8N4.2ClH/c7-6(10-8)5-1-3-9-4-2-5;;/h1-4H,8H2,(H2,7,10);2*1H
SMILES:c1cnccc1C(=NN)N.Cl.Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.