CAS 89831-00-5

2-Pyridinamine, 5-methoxy-, hydrochloride (1:1)

Description:

2-Pyridinamine, 5-methoxy-, hydrochloride (1:1), with the CAS number 89831-00-5, is a chemical compound characterized by its pyridine ring structure substituted with an amino group and a methoxy group. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The presence of the amino group contributes to its basicity, while the methoxy group can influence its reactivity and interaction with biological systems. This compound may be of interest in pharmaceutical research and development, particularly in the synthesis of biologically active molecules. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on the conditions of synthesis and storage. As with many chemical substances, proper handling and safety precautions are essential, as it may exhibit toxicity or irritant properties.

Formula: C₆H₈N₂O·ClH

InChI: InChI=1S/C6H8N2O.ClH/c1-9-5-2-3-6(7)8-4-5;/h2-4H,1H3,(H2,7,8);1H

InChI key: InChIKey=OGWHNAHBONLELP-UHFFFAOYSA-N

SMILES: O(C)C=1C=CC(N)=NC1.Cl

Synonyms:

• Pyridine, 2-amino-5-methoxy-, hydrochloride
• 2-Pyridinamine, 5-methoxy-, hydrochloride (1:1)