CAS 89831-43-6

5-Ethoxy-1H-pyrazole-3-carboxylic acid

Description:

5-Ethoxy-1H-pyrazole-3-carboxylic acid is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features an ethoxy group (-OCH2CH3) at the 5-position and a carboxylic acid group (-COOH) at the 3-position of the pyrazole ring, contributing to its acidic properties. The presence of the ethoxy group enhances its solubility in organic solvents, while the carboxylic acid group allows for hydrogen bonding and increases its polarity. This compound is often utilized in medicinal chemistry and agricultural applications due to its potential biological activities, including anti-inflammatory and antimicrobial properties. Its molecular structure allows for various chemical modifications, making it a versatile building block in drug design and synthesis. As with many pyrazole derivatives, it may exhibit interesting reactivity patterns, making it a subject of interest in research and development within the fields of pharmaceuticals and agrochemicals.

Formula: C₆H₈N₂O₃

InChI: InChI=1S/C6H8N2O3/c1-2-11-5-3-4(6(9)10)7-8-5/h3H,2H2,1H3,(H,7,8)(H,9,10)

InChI key: InChIKey=XJEVZVWMLSOJJV-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=C(OCC)NN1

Synonyms:

• Pyrazole-3(or 5)-carboxylic acid, 5(or 3)-ethoxy-
• 1H-Pyrazole-3-carboxylic acid, 5-ethoxy-
• 5-Ethoxy-1H-pyrazole-3-carboxylic acid

5-Ethoxy-1H-pyrazole-3-carboxylic acid

CAS: 89831-43-6

Versatile small molecule scaffold

Formula: C₆H₈N₂O₃

Purity: Min. 95%

Molecular weight: 156.14 g/mol

Ref: 3D-PDA83143