CAS 898386-41-9

2-(2-Methoxyphenyl)-7-methylimidazo[1,2-a]pyridine-3-carboxaldehyde

Description:

2-(2-Methoxyphenyl)-7-methylimidazo[1,2-a]pyridine-3-carboxaldehyde is a chemical compound characterized by its complex structure, which includes an imidazo[1,2-a]pyridine core, a methoxyphenyl group, and an aldehyde functional group. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and reactivity due to the presence of the aldehyde group, which can participate in various chemical reactions, including condensation and oxidation. The methoxy group may influence its solubility and polarity, affecting its interaction with biological systems. Additionally, the imidazo[1,2-a]pyridine framework is known for its presence in various pharmacologically active compounds, suggesting that this substance may have potential applications in medicinal chemistry. Its molecular structure allows for various functionalization possibilities, making it a candidate for further research in drug development or as a synthetic intermediate. As with many organic compounds, its stability, reactivity, and biological activity would depend on specific environmental conditions and the presence of other reactants.

Formula: C₁₆H₁₄N₂O₂

InChI: InChI=1S/C16H14N2O2/c1-11-7-8-18-13(10-19)16(17-15(18)9-11)12-5-3-4-6-14(12)20-2/h3-10H,1-2H3

InChI key: InChIKey=VRLURXVKVKTHCX-UHFFFAOYSA-N

SMILES: C(=O)C1=C(N=C2N1C=CC(C)=C2)C3=C(OC)C=CC=C3

Synonyms:

• Imidazo[1,2-a]pyridine-3-carboxaldehyde, 2-(2-methoxyphenyl)-7-methyl-
• 2-(2-Methoxyphenyl)-7-methylimidazo[1,2-a]pyridine-3-carboxaldehyde