CymitQuimica logo

CAS 89839-00-9

:

7-[(1,4,5-Triphenyl-1H-imidazol-2-yl)oxy]heptanoic acid

Description:
7-[(1,4,5-Triphenyl-1H-imidazol-2-yl)oxy]heptanoic acid, with the CAS number 89839-00-9, is a chemical compound characterized by its unique structure that includes a heptanoic acid backbone and a triphenyl-imidazole moiety. This compound typically exhibits properties associated with both hydrophobic and hydrophilic regions due to the presence of the long aliphatic chain and the polar imidazole ring. It may demonstrate biological activity, potentially acting as a ligand or inhibitor in various biochemical pathways. The presence of the imidazole ring suggests potential interactions with metal ions or biological macromolecules, which could be relevant in medicinal chemistry. Additionally, the compound's solubility and stability can be influenced by pH and solvent conditions, making it of interest in pharmaceutical formulations. Its synthesis and characterization would involve standard organic chemistry techniques, including purification methods such as chromatography. Overall, this compound's unique structural features may lend it utility in research and development within the fields of medicinal chemistry and biochemistry.
Formula:C28H28N2O3
InChI:InChI=1S/C28H28N2O3/c31-25(32)20-12-1-2-13-21-33-28-29-26(22-14-6-3-7-15-22)27(23-16-8-4-9-17-23)30(28)24-18-10-5-11-19-24/h3-11,14-19H,1-2,12-13,20-21H2,(H,31,32)
InChI key:InChIKey=VUUAPLHTNQCAJS-UHFFFAOYSA-N
SMILES:O(CCCCCCC(O)=O)C=1N(C(=C(N1)C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4
Synonyms:
  • Heptanoic acid, 7-[(1,4,5-triphenyl-1H-imidazol-2-yl)oxy]-
  • 7-[(1,4,5-Triphenyl-1H-imidazol-2-yl)oxy]heptanoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.