CAS 89840-72-2

N-butyl-3-nitrobenzenesulfonamide

Description:

N-butyl-3-nitrobenzenesulfonamide is an organic compound characterized by its sulfonamide functional group, which is attached to a nitro-substituted benzene ring. The presence of the butyl group contributes to its hydrophobic properties, while the nitro group introduces polarity and potential reactivity. This compound typically appears as a solid or crystalline substance and is soluble in organic solvents, with limited solubility in water due to its hydrophobic characteristics. It is often used in various chemical applications, including as an intermediate in the synthesis of pharmaceuticals and agrochemicals. The sulfonamide moiety can exhibit antibacterial properties, making it of interest in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the nitro group, which can participate in electrophilic aromatic substitution reactions. Safety data should be consulted for handling and potential hazards, as with any chemical substance. Overall, N-butyl-3-nitrobenzenesulfonamide is a versatile compound with applications in both research and industry.

Formula: C₁₀H₁₄N₂O₄S

InChI: InChI=1/C10H14N2O4S/c1-2-3-7-11-17(15,16)10-6-4-5-9(8-10)12(13)14/h4-6,8,11H,2-3,7H2,1H3

SMILES: CCCCNS(=O)(=O)c1cccc(c1)N(=O)=O

Synonyms:

• benzenesulfonamide, N-butyl-3-nitro-
• N-Butyl-3-nitrobenzenesulfonamide

N-Butyl 3-nitrobenzenesulfonamide

CAS: 89840-72-2

Formula: C₁₀H₁₄N₂O₄S

Molecular weight: 258.2942

Ref: IN-DA003SUM