
CAS 89840-74-4
:N-(1-Methylpropyl)-3-nitrobenzenesulfonamide
Description:
N-(1-Methylpropyl)-3-nitrobenzenesulfonamide, with the CAS number 89840-74-4, is an organic compound characterized by its sulfonamide functional group, which is known for its applications in pharmaceuticals and agrochemicals. This compound features a nitro group attached to a benzene ring, contributing to its potential reactivity and biological activity. The presence of the 1-methylpropyl group enhances its lipophilicity, which may influence its solubility and permeability in biological systems. Typically, sulfonamides exhibit antibacterial properties, and the nitro group may also impart additional pharmacological effects. The compound is likely to be a solid at room temperature and may have specific melting and boiling points that are characteristic of similar sulfonamide derivatives. Its synthesis and handling require standard laboratory safety protocols due to the potential hazards associated with nitro compounds and sulfonamides. Overall, N-(1-Methylpropyl)-3-nitrobenzenesulfonamide represents a class of compounds with diverse applications in medicinal chemistry and material science.
Formula:C10H14N2O4S
InChI:InChI=1S/C10H14N2O4S/c1-3-8(2)11-17(15,16)10-6-4-5-9(7-10)12(13)14/h4-8,11H,3H2,1-2H3
InChI key:InChIKey=OVHYFCHZFXUBNC-UHFFFAOYSA-N
SMILES:S(NC(CC)C)(=O)(=O)C1=CC(N(=O)=O)=CC=C1
Synonyms:- Benzenesulfonamide, N-(1-methylpropyl)-3-nitro-
- N-(1-Methylpropyl)-3-nitrobenzenesulfonamide
- 3-Nitro-benzenesulfonic acid sec-butylamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
