CAS 89840-77-7
:N,N-Bis(1-methylethyl)-3-nitrobenzenesulfonamide
Description:
N,N-Bis(1-methylethyl)-3-nitrobenzenesulfonamide, identified by its CAS number 89840-77-7, is an organic compound characterized by its sulfonamide functional group and nitro substituent on a benzene ring. This compound features two isopropyl groups (1-methylethyl) attached to the nitrogen atom, which contributes to its steric bulk and potentially influences its solubility and reactivity. The presence of the nitro group introduces electron-withdrawing characteristics, which can affect the compound's acidity and reactivity in various chemical reactions. Typically, sulfonamides exhibit antibacterial properties, and the specific structure of this compound may suggest potential applications in pharmaceuticals or agrochemicals. Its physical properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the overall structure. Safety data and handling precautions are essential, as with any chemical substance, to ensure safe usage in laboratory or industrial settings.
Formula:C12H18N2O4S
InChI:InChI=1S/C12H18N2O4S/c1-9(2)13(10(3)4)19(17,18)12-7-5-6-11(8-12)14(15)16/h5-10H,1-4H3
InChI key:InChIKey=XAZHGHKHQUDNRF-UHFFFAOYSA-N
SMILES:S(N(C(C)C)C(C)C)(=O)(=O)C1=CC(N(=O)=O)=CC=C1
Synonyms:- Benzenesulfonamide, N,N-bis(1-methylethyl)-3-nitro-
- N,N-Bis(1-methylethyl)-3-nitrobenzenesulfonamide
- Benzenesulfonamide, N,N-diisopropyl-m-nitro-
- 3-Nitro-N,N-di(propan-2-yl)benzenesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
