CAS 89840-81-3
:N-(1-Methylpropyl)-4-nitrobenzenesulfonamide
Description:
N-(1-Methylpropyl)-4-nitrobenzenesulfonamide, with the CAS number 89840-81-3, is an organic compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. This compound features a nitro group attached to a benzene ring, contributing to its potential reactivity and biological activity. The presence of the 1-methylpropyl group enhances its lipophilicity, which may influence its solubility and permeability in biological systems. Typically, sulfonamides exhibit moderate to high stability under standard conditions, although they can be sensitive to strong acids or bases. The compound may also demonstrate specific interactions with biological targets, making it of interest in medicinal chemistry. Its applications could extend to pharmaceuticals, particularly in the development of antimicrobial agents. As with many sulfonamides, it is essential to consider its toxicity and environmental impact during handling and application. Overall, N-(1-Methylpropyl)-4-nitrobenzenesulfonamide represents a unique structure within the sulfonamide class, with potential implications in various chemical and biological fields.
Formula:C10H14N2O4S
InChI:InChI=1S/C10H14N2O4S/c1-3-8(2)11-17(15,16)10-6-4-9(5-7-10)12(13)14/h4-8,11H,3H2,1-2H3
InChI key:InChIKey=AFESPGHMFBWEIW-UHFFFAOYSA-N
SMILES:S(NC(CC)C)(=O)(=O)C1=CC=C(N(=O)=O)C=C1
Synonyms:- Benzenesulfonamide, N-(1-methylpropyl)-4-nitro-
- N-(1-Methylpropyl)-4-nitrobenzenesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
