CAS 89843-47-0
:5-Nitrobenzimidazole
Description:
5-Nitrobenzimidazole is an organic compound characterized by its fused bicyclic structure, which consists of a benzene ring and an imidazole ring. The presence of a nitro group (-NO2) at the 5-position of the benzimidazole structure contributes to its chemical reactivity and properties. This compound is typically a yellow crystalline solid and is known for its applications in various fields, including pharmaceuticals and agrochemicals. It exhibits moderate solubility in organic solvents and limited solubility in water, which is common for many nitro-substituted aromatic compounds. The nitro group can influence the compound's electronic properties, making it a potential candidate for further chemical modifications or as a precursor in synthetic pathways. Additionally, 5-nitrobenzimidazole may exhibit biological activity, which has been explored in research contexts, particularly in relation to its potential as an antimicrobial or anticancer agent. As with many nitro compounds, safety precautions should be taken due to potential toxicity and environmental impact.
Formula:C7H5N3O2
InChI:InChI=1S/C7H5N3O2/c11-10(12)5-1-2-6-7(3-5)9-4-8-6/h1-4H,(H,8,9)
InChI key:InChIKey=XPAZGLFMMUODDK-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C=C2C(=CC1)N=CN2
Synonyms:- 1H-Benzimidazole, 5-nitro-
- Benzimidazole, 5-nitro-
- 1H-Benzimidazole, 6-nitro-
- 6-Nitro-1H-benzimidazole
- Benzimidazole, 5(or 6)-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
