CymitQuimica logo

CAS 89843-49-2

:

6-Nitro-2-(trifluoromethyl)-1H-benzimidazole

Description:
6-Nitro-2-(trifluoromethyl)-1H-benzimidazole is a chemical compound characterized by its unique structural features, which include a benzimidazole core substituted with a nitro group and a trifluoromethyl group. The presence of the nitro group typically imparts significant electron-withdrawing properties, influencing the compound's reactivity and potential applications in various chemical reactions. The trifluoromethyl group is known for enhancing lipophilicity and stability, making the compound potentially useful in medicinal chemistry and agrochemical applications. This compound may exhibit biological activity, which can be attributed to its structural motifs, and is often studied for its potential as a pharmaceutical intermediate or in the development of new materials. Its CAS number, 89843-49-2, serves as a unique identifier for regulatory and research purposes. Overall, the combination of these functional groups contributes to the compound's distinctive chemical behavior and potential utility in various fields of research and industry.
Formula:C8H4F3N3O2
InChI:InChI=1S/C8H4F3N3O2/c9-8(10,11)7-12-5-2-1-4(14(15)16)3-6(5)13-7/h1-3H,(H,12,13)
InChI key:InChIKey=FEJRBJIEEALTTL-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1NC=2C(N1)=CC=C(N(=O)=O)C2
Synonyms:
  • 1H-Benzimidazole, 6-nitro-2-(trifluoromethyl)-
  • 1H-Benzimidazole, 5-nitro-2-(trifluoromethyl)-
  • Benzimidazole, 5(or 6)-nitro-2-(trifluoromethyl)-
  • Benzimidazole, 5-nitro-2-(trifluoromethyl)-
  • 6-Nitro-2-(trifluoromethyl)-1H-benzimidazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.