CymitQuimica logo

CAS 89847-03-0

:

1,1′-Sulfonylbis[4-[(4-nitrophenyl)thio]benzene]

Description:
1,1′-Sulfonylbis[4-[(4-nitrophenyl)thio]benzene], with the CAS number 89847-03-0, is an organic compound characterized by its complex structure that includes a sulfonyl group and two 4-(4-nitrophenylthio)benzene moieties. This compound typically exhibits properties associated with aromatic compounds, such as stability and relatively high melting and boiling points. The presence of the nitro group contributes to its electron-withdrawing characteristics, which can influence its reactivity and solubility in various solvents. Additionally, the thioether linkages provide potential for further chemical modifications and applications in organic synthesis. Due to its structural features, this compound may be of interest in materials science, particularly in the development of dyes, pigments, or as intermediates in the synthesis of more complex organic molecules. Its specific applications and behavior would depend on the context of use, including interactions with other chemical species and environmental factors.
Formula:C24H16N2O6S3
InChI:InChI=1S/C24H16N2O6S3/c27-25(28)17-1-5-19(6-2-17)33-21-9-13-23(14-10-21)35(31,32)24-15-11-22(12-16-24)34-20-7-3-18(4-8-20)26(29)30/h1-16H
InChI key:InChIKey=ACZTTXMGEQGRHE-UHFFFAOYSA-N
SMILES:S(=O)(=O)(C1=CC=C(SC2=CC=C(N(=O)=O)C=C2)C=C1)C3=CC=C(SC4=CC=C(N(=O)=O)C=C4)C=C3
Synonyms:
  • 1,1′-Sulfonylbis[4-[(4-nitrophenyl)thio]benzene]
  • Benzene, 1,1′-sulfonylbis[4-[(4-nitrophenyl)thio]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.