CAS 89850-37-3
:4-chloro-6-(1,2-dimethylhydrazinyl)pyrimidin-5-amine
Description:
4-Chloro-6-(1,2-dimethylhydrazinyl)pyrimidin-5-amine is a chemical compound characterized by its pyrimidine core, which is a six-membered aromatic ring containing two nitrogen atoms. The presence of a chlorine atom at the 4-position and a 1,2-dimethylhydrazinyl group at the 6-position contributes to its unique reactivity and potential biological activity. This compound is often studied in the context of medicinal chemistry, particularly for its potential as an antitumor agent or in other therapeutic applications. Its structure allows for various interactions with biological targets, making it of interest in drug development. The compound is typically synthesized through multi-step organic reactions, and its properties can be influenced by the substituents on the pyrimidine ring. As with many nitrogen-containing heterocycles, it may exhibit interesting solubility and stability characteristics, which are important for its application in pharmaceuticals. Safety and handling precautions should be observed due to the presence of chlorine and hydrazine derivatives, which can be hazardous.
Formula:C6H10ClN5
InChI:InChI=1/C6H10ClN5/c1-9-12(2)6-4(8)5(7)10-3-11-6/h3,9H,8H2,1-2H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
