CAS 89852-78-8
:2,4-Diamino-5,6,7,8-tetrahydro-6-pteridinemethanol
Description:
2,4-Diamino-5,6,7,8-tetrahydro-6-pteridinemethanol, with the CAS number 89852-78-8, is a chemical compound that belongs to the pteridine family, which is characterized by a bicyclic structure containing nitrogen atoms. This compound features multiple amino groups, which contribute to its potential as a biological active agent. It is typically a white to off-white solid and is soluble in polar solvents, reflecting its ability to interact with various biological systems. The presence of the tetrahydro-pteridine structure suggests that it may participate in biochemical pathways, possibly acting as a precursor or intermediate in the synthesis of other biologically relevant molecules. Its amino groups can engage in hydrogen bonding, enhancing its reactivity and interaction with other compounds. This substance may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural similarity to folate and other important biomolecules. However, specific biological activities and safety profiles would require further investigation through empirical studies.
Formula:C7H12N6O
InChI:InChI=1S/C7H12N6O/c8-5-4-6(13-7(9)12-5)10-1-3(2-14)11-4/h3,11,14H,1-2H2,(H5,8,9,10,12,13)
InChI key:InChIKey=PNJIYVKCMQLCPQ-UHFFFAOYSA-N
SMILES:NC1=C2C(=NC(N)=N1)NCC(CO)N2
Synonyms:- (2,4-Diamino-5,6,7,8-tetrahydropteridin-6-yl)methanol
- (2,4-Diamino-1,5,6,7-tetrahydropteridin-6-yl)methanol
- 6-Pteridinemethanol, 2,4-diamino-1,5,6,7-tetrahydro-
- 6-Pteridinemethanol, 2,4-diamino-5,6,7,8-tetrahydro-
- 2,4-Diamino-5,6,7,8-tetrahydro-6-pteridinemethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
