CAS 89853-54-3

4-Pyridinecarboxylic acid, 1-methylhydrazide

Description:

4-Pyridinecarboxylic acid, 1-methylhydrazide, also known by its CAS number 89853-54-3, is an organic compound characterized by its pyridine and hydrazide functional groups. This substance typically appears as a solid and is soluble in polar solvents, reflecting its polar nature due to the presence of both the carboxylic acid and hydrazide moieties. The compound is known for its potential applications in pharmaceuticals and agrochemicals, often serving as an intermediate in the synthesis of more complex molecules. Its structure allows for hydrogen bonding, which can influence its reactivity and interactions with other chemical species. Additionally, the presence of the methylhydrazide group may impart biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity. Overall, 4-Pyridinecarboxylic acid, 1-methylhydrazide is a versatile compound with significant implications in various chemical research fields.

Formula: C₇H₉N₃O

InChI: InChI=1S/C7H9N3O/c1-10(8)7(11)6-2-4-9-5-3-6/h2-5H,8H2,1H3

InChI key: InChIKey=ZPXUPNFFWCPHBL-UHFFFAOYSA-N

SMILES: C(N(C)N)(=O)C=1C=CN=CC1

Synonyms:

• Isonicotinic acid, 1-methylhydrazide
• 1-Methyl-1-isonicotinoylhydrazine
• 4-Pyridinecarboxylic acid, 1-methylhydrazide