CymitQuimica logo

CAS 89853-75-8

:

3-pyridazin-3-ylalanine

Description:
3-Pyridazin-3-ylalanine is an organic compound characterized by the presence of a pyridazine ring, which is a six-membered heterocyclic structure containing two nitrogen atoms at positions 1 and 2. This compound features an alanine moiety, an amino acid known for its simple structure and role in protein synthesis. The combination of the pyridazine ring and the alanine side chain imparts unique chemical properties, including potential interactions with biological systems, making it of interest in medicinal chemistry and drug design. The presence of the amino group (-NH2) and the carboxylic acid group (-COOH) in the alanine structure contributes to its ability to participate in hydrogen bonding and other intermolecular interactions. Additionally, the pyridazine ring can engage in π-π stacking and other electronic interactions, which may influence the compound's reactivity and solubility. Overall, 3-pyridazin-3-ylalanine represents a versatile structure that may exhibit interesting pharmacological activities, warranting further investigation in various chemical and biological contexts.
Formula:C7H9N3O2
InChI:InChI=1/C7H9N3O2/c8-6(7(11)12)4-5-2-1-3-9-10-5/h1-3,6H,4,8H2,(H,11,12)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.