CymitQuimica logo

CAS 89853-76-9

:

4-Pyridazinealanine

Description:
4-Pyridazinealanine, with the CAS number 89853-76-9, is an amino acid derivative characterized by the presence of a pyridazine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH), typical of amino acids, allowing it to participate in peptide bond formation and biological processes. The pyridazine moiety contributes to its unique chemical properties, potentially influencing its reactivity and interactions with biological systems. 4-Pyridazinealanine may exhibit specific solubility characteristics, stability under various pH conditions, and potential bioactivity, making it of interest in pharmaceutical and biochemical research. Its structural features may also allow for interactions with enzymes or receptors, suggesting potential applications in drug development or as a biochemical probe. However, detailed studies would be necessary to fully elucidate its properties, including its synthesis, stability, and biological activity.
Formula:C7H9N3O2
InChI:InChI=1S/C7H9N3O2/c8-6(7(11)12)3-5-1-2-9-10-4-5/h1-2,4,6H,3,8H2,(H,11,12)
InChI key:InChIKey=IOIQFYKCCUDSQT-UHFFFAOYSA-N
SMILES:C(C(C(O)=O)N)C=1C=CN=NC1
Synonyms:
  • 4-Pyridazinealanine
  • 2-Amino-3-(pyridazin-4-yl)propanoic acid
  • NSC 88416
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.