CymitQuimica logo

CAS 89854-62-6

:

3-(2-Methylpropyl)azetidine

Description:
3-(2-Methylpropyl)azetidine is a cyclic amine characterized by its four-membered ring structure, which includes a nitrogen atom. This compound features a branched alkyl substituent, specifically a 2-methylpropyl group, attached to the third carbon of the azetidine ring. The presence of the nitrogen atom contributes to its basicity and potential reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions and ring-opening reactions. The molecular structure imparts unique steric and electronic properties, influencing its behavior in chemical synthesis and potential applications in pharmaceuticals or agrochemicals. Additionally, azetidine derivatives are of interest in medicinal chemistry due to their ability to mimic natural products and their role in biological systems. The compound's physical properties, such as boiling point, melting point, and solubility, would depend on its molecular interactions and the presence of functional groups. Overall, 3-(2-Methylpropyl)azetidine represents a versatile building block in organic synthesis and materials science.
Formula:C7H15N
InChI:InChI=1S/C7H15N/c1-6(2)3-7-4-8-5-7/h6-8H,3-5H2,1-2H3
InChI key:InChIKey=QCGPDCBREKQOTK-UHFFFAOYSA-N
SMILES:C(C(C)C)C1CNC1
Synonyms:
  • 3-(2-Methylpropyl)azetidine
  • Azetidine, 3-(2-methylpropyl)-
  • 3-Isobutyl-azetidine
  • Azetidine, 3-isobutyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.