CymitQuimica logo

CAS 89854-72-8

:

Cyclopentanamine, N,1-dimethyl-, hydrochloride (1:1)

Description:
Cyclopentanamine, N,1-dimethyl-, hydrochloride (1:1) is a chemical compound characterized by its amine functional group and a cyclopentane ring structure. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its stability and solubility in water. The presence of the dimethyl substitution on the nitrogen atom contributes to its basicity and potential reactivity, making it relevant in various chemical synthesis applications. This compound may exhibit properties typical of amines, such as being a weak base and forming hydrogen bonds, which can influence its interactions in biological systems. Additionally, its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting the central nervous system. Safety data should be consulted for handling, as amines can be irritants, and the hydrochloride form may have specific storage and stability considerations. Overall, Cyclopentanamine, N,1-dimethyl-, hydrochloride is a compound of interest in both synthetic chemistry and medicinal chemistry contexts.
Formula:C7H15N.ClH
InChI:InChI=1S/C7H15N.ClH/c1-7(8-2)5-3-4-6-7;/h8H,3-6H2,1-2H3;1H
InChI key:InChIKey=RFLHDUUAIXWGNM-UHFFFAOYSA-N
SMILES:N(C)C1(C)CCCC1.Cl
Found 4 products.