CAS 89856-45-1

2-(2-Bromoethyl)-6-methyl-3(2H)-pyridazinone

Description:

2-(2-Bromoethyl)-6-methyl-3(2H)-pyridazinone, with the CAS number 89856-45-1, is a chemical compound that belongs to the class of pyridazinones, which are characterized by a pyridazine ring fused with a carbonyl group. This compound features a bromoethyl substituent, which enhances its reactivity and potential applications in organic synthesis. The presence of the methyl group at the 6-position of the pyridazinone ring contributes to its structural diversity and may influence its biological activity. Typically, compounds of this nature exhibit moderate to high polarity due to the presence of functional groups, which can affect their solubility in various solvents. Additionally, the bromine atom can serve as a leaving group in nucleophilic substitution reactions, making this compound useful in medicinal chemistry and the development of pharmaceuticals. Its specific properties, such as melting point, boiling point, and spectral characteristics, would need to be determined through experimental methods or referenced from chemical databases for precise applications.

Formula: C₇H₉BrN₂O

InChI: InChI=1S/C7H9BrN2O/c1-6-2-3-7(11)10(9-6)5-4-8/h2-3H,4-5H2,1H3

InChI key: InChIKey=YTUPFPALSRJFIF-UHFFFAOYSA-N

SMILES: C(CBr)N1C(=O)C=CC(C)=N1

Synonyms:

• 2-(2-Bromoethyl)-6-methyl-3(2H)-pyridazinone
• 3(2H)-Pyridazinone, 2-(2-bromoethyl)-6-methyl-
• 2-(2-Bromoethyl)-6-methyl-2,3-dihydropyridazin-3-one