CAS 89856-65-5
:chloro(3-oxobicyclo[2.2.1]hept-2-yl)mercury
Description:
Chloro(3-oxobicyclo[2.2.1]hept-2-yl)mercury, with the CAS number 89856-65-5, is an organomercury compound characterized by the presence of a mercury atom bonded to a chloro group and a bicyclic structure. This compound features a bicyclo[2.2.1]heptane framework, which is a polycyclic structure known for its unique ring system. The presence of the 3-oxo group indicates that there is a ketone functional group attached to the bicyclic structure, contributing to its reactivity and potential applications in organic synthesis. Organomercury compounds are often used in various chemical reactions, including as catalysts or intermediates in organic synthesis. However, due to the toxicity associated with mercury, handling and disposal of such compounds require strict safety protocols. The compound's physical properties, such as solubility and melting point, can vary based on its specific structure and the conditions under which it is studied. Overall, chloro(3-oxobicyclo[2.2.1]hept-2-yl)mercury exemplifies the diverse chemistry of organomercury compounds.
Formula:C7H9ClHgO
InChI:InChI=1/C7H9O.ClH.Hg/c8-7-4-5-1-2-6(7)3-5;;/h4-6H,1-3H2;1H;/q;;+1/p-1/rC7H9ClHgO/c8-9-6-4-1-2-5(3-4)7(6)10/h4-6H,1-3H2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
