CAS 898561-60-9
:N-(4-methoxy-2-pyridyl)-2,2-dimethyl-propanamide
Description:
N-(4-methoxy-2-pyridyl)-2,2-dimethyl-propanamide is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a methoxy group and an amide functional group. This compound typically exhibits properties associated with both amides and aromatic heterocycles. It is likely to be a solid at room temperature, with moderate solubility in organic solvents due to the presence of the methoxy group, which can enhance its polarity. The pyridine moiety may contribute to its potential biological activity, as many pyridine derivatives are known for their pharmacological properties. The presence of the dimethyl group on the propanamide backbone can influence its steric hindrance and reactivity. Overall, this compound may be of interest in medicinal chemistry and drug development, particularly in the search for new therapeutic agents. However, specific physical and chemical properties such as melting point, boiling point, and spectral data would require experimental determination or detailed literature references for precise characterization.
Formula:C11H16N2O2
InChI:InChI=1/C11H16N2O2/c1-11(2,3)10(14)13-9-7-8(15-4)5-6-12-9/h5-7H,1-4H3,(H,12,13,14)
SMILES:CC(C)(C)C(=Nc1cc(ccn1)OC)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
