CAS 898561-62-1

N-(3-iodo-4-methoxy-2-pyridyl)-2,2-dimethyl-propanamide

Description:

N-(3-iodo-4-methoxy-2-pyridyl)-2,2-dimethyl-propanamide is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with an iodine atom and a methoxy group. The presence of the amide functional group indicates that it can participate in hydrogen bonding, influencing its solubility and reactivity. This compound is likely to exhibit moderate polarity due to the combination of the hydrophobic dimethyl groups and the polar amide and methoxy functionalities. Its iodine substitution may impart specific electronic properties, potentially affecting its reactivity in nucleophilic substitution reactions. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where the pyridine moiety is often associated with biological activity. Additionally, the presence of the iodine atom may enhance the compound's utility in various synthetic pathways, including radiolabeling or as a precursor in organic synthesis. Overall, this compound's characteristics make it a subject of interest in both research and application within the field of chemistry.

Formula: C₁₁H₁₅IN₂O₂

InChI: InChI=1/C11H15IN2O2/c1-11(2,3)10(15)14-9-8(12)7(16-4)5-6-13-9/h5-6H,1-4H3,(H,13,14,15)

SMILES: CC(C)(C)C(=Nc1c(c(ccn1)OC)I)O

N-(3-Iodo-4-methoxy-pyridin-2-yl)-2,2-dimethyl-propionamide

CAS: 898561-62-1

Formula: C₁₁H₁₅IN₂O₂

Molecular weight: 334.1535

Ref: IN-DA003XD7