CAS 898561-63-2
:3-(5-methoxy-3-pyridyl)prop-2-yn-1-ol
Description:
3-(5-Methoxy-3-pyridyl)prop-2-yn-1-ol, identified by its CAS number 898561-63-2, is an organic compound featuring a propargyl alcohol structure with a pyridine ring substituted at the 5-position with a methoxy group. This compound typically exhibits characteristics associated with both alcohols and heterocyclic aromatic compounds. It is likely to be a polar molecule due to the presence of the hydroxyl (-OH) group, which can engage in hydrogen bonding, influencing its solubility in polar solvents like water. The methoxy group contributes to the compound's overall electronic properties, potentially affecting its reactivity and interaction with biological systems. Additionally, the presence of the pyridine ring may impart basicity and influence the compound's behavior in various chemical reactions. Such compounds can be of interest in medicinal chemistry and material science due to their potential biological activity and utility in synthesizing more complex molecules. However, specific properties such as melting point, boiling point, and spectral data would require empirical measurement or detailed literature references for precise characterization.
Formula:C9H9NO2
InChI:InChI=1/C9H9NO2/c1-12-9-5-8(3-2-4-11)6-10-7-9/h5-7,11H,4H2,1H3
SMILES:COc1cc(C#CCO)cnc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
