CAS 898561-64-3
:3-[5-(dimethoxymethyl)-3-pyridyl]prop-2-yn-1-ol
Description:
3-[5-(Dimethoxymethyl)-3-pyridyl]prop-2-yn-1-ol, with the CAS number 898561-64-3, is a chemical compound characterized by its unique structure that includes a pyridine ring and an alkyne functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and stability. The presence of the dimethoxymethyl group enhances its solubility in organic solvents and may influence its biological activity. As a propargyl alcohol derivative, it can participate in various chemical reactions, including nucleophilic additions and coupling reactions, making it a valuable intermediate in organic synthesis. Additionally, the compound may exhibit specific pharmacological properties, which could be of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways. Overall, the characteristics of this compound make it a subject of interest for further research in both synthetic and medicinal chemistry contexts.
Formula:C11H13NO3
InChI:InChI=1/C11H13NO3/c1-14-11(15-2)10-6-9(4-3-5-13)7-12-8-10/h6-8,11,13H,5H2,1-2H3
SMILES:COC(c1cc(C#CCO)cnc1)OC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
